Infos
Products
HPMA
[+] add to notepad2-Hydroxypropyl Methacrylate
CH2=C(CH3)COO-CH2CH(OH)CH3
CAS 27813-02-1
EINECS
248-666-3
Description:
▹ Thermo setting Agent ▹ Textile Treatment agent ▹ Polymer Modifier ▹ Paper processing material ▹ Adhesive
Form of Delivery:
mass/unit:
packaging:
| Name | Chemical Name | CAS | EINECS | |
|---|---|---|---|---|
| ↦ 701 | 2-Hydroxy 1-3dimethacryloxy Propane | 1830-78-0 | 217-388-4 | |
| ↦ 1206PE | Ethoxylated Polypropyreneglycol Dimethacrylate (PO12/EO6) | 184723-08-8 | not listed | |
| ↦ 1G | Ethylene Glycol Dimethacrylate | 97-90-5 | 202-617-2 | |
| ↦ 2G | Diethylene Glycol Dimethacrylate | 2358-84-1 | 219-099-9 | |
| ↦ 3EDMA | Triethleneglycol Dimethacrylate | 109-16-0 | 203-652-6 | |
| ↦ 3G | Triethyleneglycol Dimethacrylate | 109-16-0 | 203-652-6 | |
| ↦ 3PG | Tripropylene Glycol Dimethacrylate | 51247-87-1 | not listed | |
| ↦ 9PG | Polypropylene Glycol 400 Dimethac?late | 25852-49-7 | not listed | |
| ↦ BD | 1,4-Butane Diol Dimethacrylate | 2082-81-7 | 218-218-1 | |
| ↦ BDMA | 1.3 Butyleneglycol Dimethacrylate | 1189-08-8 | 214-711-0 | |
| ↦ BG | 1,3-Butane Diol Dimethacrylate | 1189-08-8 | 214-711-0 | |
| ↦ BPE-100 | 2.2 Bis [4-(Methacryloxy Ethoxy) Phenyl] Propane (EO2.6mol) | 41637-38-1 | not listed | |
| ↦ BPE-200 | 2.2 Bis [4-(Methacryloxy Diethoxy) Phenyl] Propane (EO4mol) | 41637-38-1 | not listed | |
| ↦ BPE-300 | 2.2 Bis [4-(Methacryloxy Polyethoxy) Phenyl] Propane (EO6mol) | 41637-38-1 | not listed | |
| ↦ DCP | Tricyclodecane dimethanol Dimethacrylate | 43048-08-4 | 256-062-6 | |
| ↦ DOD-N | 1,10 Dodecanediol Dimethacrylate | 6701-13-9 | 229-745-1 | |
| ↦ EDMA | Ethleneglycol Dimethacrylate | 97-90-5 | 202-617-2 | |
| ↦ HD-N | 1.6-Hexane Diol Dimethacrylate | 6606-59-3 | 229-551-7 | |
| ↦ HXMA | 1.6-Hexanediol Dimethacrylate | 6606-59-3 | 229-551-7 | |
| ↦ IND | 2-Methyl-1,8-octanediol Dimethacrylate | 120703-10-8 | not listed | |
| ↦ NOD | 1.9-Nonanediol Dimethacrylate | 65833-30-9 | not listed | |
| ↦ NPG | Neopentyl Glycol Dimethacrylate | 1985-51-9 | 217-856-8 | |
| ↦ PBOM | Polybutyleneglycol Dimethacrylate | 28883-57-0 | not listed | |
